ChemNet > CAS > 7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
상품명칭 |
1,3-dichloro-2-methyl-5-nitrobenzene |
별명 |
2,6-Dichloro-4-nitrotoluene |
분자식 |
C7H5Cl2NO2 |
분자량 |
206.0261 |
InChI |
InChI=1/C7H5Cl2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
cas번호 |
7149-69-1 |
분자 구조 |
|
밀도 |
1.456g/cm3 |
녹는 점 |
62℃ |
비등점 |
279.6°C at 760 mmHg |
굴절 지수 |
1.585 |
인화점 |
122.9°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|