ChemNet > CAS > 7152-24-1 2-(Methylmercapto)benzimidazole
7152-24-1 2-(Methylmercapto)benzimidazole
상품명칭 |
2-(Methylmercapto)benzimidazole |
별명 |
2-(Methylthio)benzimidazole; 2-(methylsulfanyl)-1H-benzimidazole |
분자식 |
C8H8N2S |
분자량 |
164.2275 |
InChI |
InChI=1/C8H8N2S/c1-11-8-9-6-4-2-3-5-7(6)10-8/h2-5H,1H3,(H,9,10) |
cas번호 |
7152-24-1 |
EC번호 |
230-494-5 |
분자 구조 |
|
밀도 |
1.29g/cm3 |
녹는 점 |
202-205℃ |
비등점 |
347.2°C at 760 mmHg |
굴절 지수 |
1.691 |
인화점 |
163.8°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|