ChemNet > CAS > 71642-16-5 3-Methyl-2,4,6-tribromoaniline
71642-16-5 3-Methyl-2,4,6-tribromoaniline
상품명칭 |
3-Methyl-2,4,6-tribromoaniline |
별명 |
2,4,6-Tribromo-3-methylaniline~2,4,6-Tribromo-m-toluidine; 2,4,6-Tribromo-m-toluidine; 2,4,6-tribromo-3-methylaniline |
분자식 |
C7H6Br3N |
분자량 |
343.8412 |
InChI |
InChI=1/C7H6Br3N/c1-3-4(8)2-5(9)7(11)6(3)10/h2H,11H2,1H3 |
cas번호 |
71642-16-5 |
분자 구조 |
|
밀도 |
2.196g/cm3 |
녹는 점 |
101-102℃ |
비등점 |
314.1°C at 760 mmHg |
굴절 지수 |
1.668 |
인화점 |
143.8°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|