ChemNet > CAS > 7197-96-8 2,3-cycloheptenopyridine
7197-96-8 2,3-cycloheptenopyridine
상품명칭 |
2,3-cycloheptenopyridine |
분자식 |
C10H13N |
분자량 |
147.2169 |
InChI |
InChI=1/C10H13N/c1-2-5-9-6-4-8-11-10(9)7-3-1/h4,6,8H,1-3,5,7H2 |
cas번호 |
7197-96-8 |
EC번호 |
230-568-7 |
분자 구조 |
|
밀도 |
0.999g/cm3 |
비등점 |
224.9°C at 760 mmHg |
굴절 지수 |
1.533 |
인화점 |
93.3°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|