ChemNet > CAS > 72235-55-3 3-Chloro-2-fluorobenzylamine
72235-55-3 3-Chloro-2-fluorobenzylamine
상품명칭 |
3-Chloro-2-fluorobenzylamine |
별명 |
1-(3-chloro-2-fluorophenyl)methanamine |
분자식 |
C7H7ClFN |
분자량 |
159.5886 |
InChI |
InChI=1/C7H7ClFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4,10H2 |
cas번호 |
72235-55-3 |
분자 구조 |
|
밀도 |
1.27g/cm3 |
비등점 |
219.6°C at 760 mmHg |
굴절 지수 |
1.543 |
인화점 |
86.6°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|