ChemNet > CAS > 72752-52-4 2-Piperidinobenzonitrile
72752-52-4 2-Piperidinobenzonitrile
| 상품명칭 |
2-Piperidinobenzonitrile |
| 별명 |
2-(1-Piperidino)benzonitrile; 2-piperidin-1-ylbenzonitrile |
| 분자식 |
C12H14N2 |
| 분자량 |
186.253 |
| InChI |
InChI=1/C12H14N2/c13-10-11-6-2-3-7-12(11)14-8-4-1-5-9-14/h2-3,6-7H,1,4-5,8-9H2 |
| cas번호 |
72752-52-4 |
| EC번호 |
427-330-1 |
| 분자 구조 |
|
| 밀도 |
1.09g/cm3 |
| 녹는 점 |
48-50℃ |
| 비등점 |
336.9°C at 760 mmHg |
| 굴절 지수 |
1.577 |
| 인화점 |
147.5°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
