ChemNet > CAS > 729-43-1 Acetophenone Azine
729-43-1 Acetophenone Azine
| 상품명칭 |
Acetophenone Azine |
| 별명 |
Ethanone, 1-phenyl-, 2-(1-phenylethylidene)hydrazone; Acetophenone azine; Ethanone, 1-phenyl-, (1-phenylethylidene)hydrazone; NSC 25772; 1-Phenylethan-1-one (1-phenylethylidene)hydrazone; Acetophenone, azine (8CI); bis(1-phenylethylidene)hydrazine; (1Z,2Z)-bis(1-phenylethylidene)hydrazine; (1E,2E)-bis(1-phenylethylidene)hydrazine |
| 분자식 |
C16H16N2 |
| 분자량 |
236.3116 |
| InChI |
InChI=1/C16H16N2/c1-13(15-9-5-3-6-10-15)17-18-14(2)16-11-7-4-8-12-16/h3-12H,1-2H3/b17-13+,18-14+ |
| cas번호 |
729-43-1 |
| EC번호 |
211-979-0 |
| 분자 구조 |
|
| 밀도 |
0.98g/cm3 |
| 비등점 |
333.2°C at 760 mmHg |
| 굴절 지수 |
1.551 |
| 인화점 |
147.4°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
