ChemNet > CAS > 74037-50-6 3-Ethoxy-2-nitropyridine
74037-50-6 3-Ethoxy-2-nitropyridine
| 상품명칭 |
3-Ethoxy-2-nitropyridine |
| 별명 |
Pyridine, 3-ethoxy-2-nitro-; 4-21-00-00436 (Beilstein Handbook Reference); BRN 0141592 |
| 분자식 |
C7H8N2O3 |
| 분자량 |
168.15 |
| InChI |
InChI=1/C7H8N2O3/c1-2-12-6-4-3-5-8-7(6)9(10)11/h3-5H,2H2,1H3 |
| cas번호 |
74037-50-6 |
| EC번호 |
277-676-0 |
| 분자 구조 |
|
| 밀도 |
1.245g/cm3 |
| 녹는 점 |
28-32℃ |
| 비등점 |
274.2°C at 760 mmHg |
| 굴절 지수 |
1.537 |
| 인화점 |
146.9°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|
