ChemNet > CAS > 7423-93-0 3-Chloro-L-tyrosine
7423-93-0 3-Chloro-L-tyrosine
상품명칭 |
3-Chloro-L-tyrosine |
별명 |
3-Chloro-4-hydroxy-L-phenylalanine~H-Tyr(3-Cl)-OH; 3-chlorotyrosine; H-Tyr(3-Cl)-OH |
분자식 |
C9H10ClNO3 |
분자량 |
215.6336 |
InChI |
InChI=1/C9H10ClNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14) |
cas번호 |
7423-93-0 |
EC번호 |
231-050-3 |
분자 구조 |
|
밀도 |
1.458g/cm3 |
녹는 점 |
249℃ |
비등점 |
388.6°C at 760 mmHg |
굴절 지수 |
1.625 |
인화점 |
188.8°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|