ChemNet > CAS > 7424-54-6 3,5-Heptanedione
7424-54-6 3,5-Heptanedione
상품명칭 |
3,5-Heptanedione |
별명 |
heptane-3,5-dione; (4Z)-5-hydroxyhept-4-en-3-one; 3,5-HEPTANDIONE |
분자식 |
C7H12O2 |
분자량 |
128.169 |
InChI |
InChI=1/C7H12O2/c1-3-6(8)5-7(9)4-2/h5,8H,3-4H2,1-2H3/b6-5- |
cas번호 |
7424-54-6 |
EC번호 |
231-054-5 |
분자 구조 |
|
밀도 |
0.97g/cm3 |
비등점 |
216.1°C at 760 mmHg |
굴절 지수 |
1.456 |
인화점 |
86.3°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|