ChemNet > CAS > 758-12-3 Acetic acid-d
758-12-3 Acetic acid-d
| 상품명칭 |
Acetic acid-d |
| 별명 |
Acetic acid-d1; acetate; (O-~2~H)acetic acid |
| 분자식 |
C2H3DO2 |
| 분자량 |
61.0581 |
| InChI |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i/hD |
| cas번호 |
758-12-3 |
| EC번호 |
212-059-1 |
| 분자 구조 |
|
| 밀도 |
1.086g/cm3 |
| 녹는 점 |
15-16℃ |
| 비등점 |
117.1°C at 760 mmHg |
| 굴절 지수 |
1.375 |
| 인화점 |
40°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R10:Flammable.;
R35:Causes severe burns.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
