ChemNet > CAS > 758-16-7 N,N-Dimethylthioformamide
758-16-7 N,N-Dimethylthioformamide
상품명칭 |
N,N-Dimethylthioformamide |
별명 |
NN-Dimethylthioformamide |
분자식 |
C3H7NS |
분자량 |
89.1594 |
InChI |
InChI=1/C3H7NS/c1-4(2)3-5/h3H,1-2H3 |
cas번호 |
758-16-7 |
EC번호 |
212-060-7 |
분자 구조 |
|
밀도 |
0.985g/cm3 |
비등점 |
224.9°C at 760 mmHg |
굴절 지수 |
1.511 |
인화점 |
89.8°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21:Harmful by inhalation and in contact with skin.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|