ChemNet > CAS > 76141-89-4 1-(4-fluorobenzyl)-1,4-diazepane
76141-89-4 1-(4-fluorobenzyl)-1,4-diazepane
상품명칭 |
1-(4-fluorobenzyl)-1,4-diazepane |
분자식 |
C12H17FN2 |
분자량 |
208.2752 |
InChI |
InChI=1/C12H17FN2/c13-12-4-2-11(3-5-12)10-15-8-1-6-14-7-9-15/h2-5,14H,1,6-10H2 |
cas번호 |
76141-89-4 |
분자 구조 |
|
밀도 |
1.074g/cm3 |
비등점 |
291.7°C at 760 mmHg |
굴절 지수 |
1.522 |
인화점 |
130.2°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|