ChemNet > CAS > 765-87-7 1,2-Cyclohexanedione
765-87-7 1,2-Cyclohexanedione
상품명칭 |
1,2-Cyclohexanedione |
별명 |
1,2-Dioxocyclohexane; 4-07-00-01982 (Beilstein Handbook Reference); AI3-25042; BRN 0507419; CCRIS 6296; NSC 32950; cyclohexane-1,2-dione |
분자식 |
C12H18O3 |
분자량 |
210.2695 |
InChI |
InChI=1/C12H18O3/c1-3-7-11-9(5-1)13-12(15-11)8-4-2-6-10(12)14-11/h9-10H,1-8H2 |
cas번호 |
765-87-7 |
EC번호 |
212-155-3 |
분자 구조 |
|
녹는 점 |
35-38℃ |
굴절 지수 |
1.546 |
물 용해도 |
soluble |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|