ChemNet > CAS > 77-04-3 Pyrithyldione
77-04-3 Pyrithyldione
상품명칭 |
Pyrithyldione |
별명 |
3,3-Diethyl-2,4(1H,3H)-pyridinedione; 3,3-diethylpyridine-2,4(1H,3H)-dione |
분자식 |
C9H13NO2 |
분자량 |
167.205 |
InChI |
InChI=1/C9H13NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h5-6H,3-4H2,1-2H3,(H,10,12) |
cas번호 |
77-04-3 |
EC번호 |
201-000-5 |
분자 구조 |
|
밀도 |
1.029g/cm3 |
비등점 |
330.2°C at 760 mmHg |
굴절 지수 |
1.464 |
인화점 |
147.8°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21:Harmful by inhalation and in contact with skin.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|