ChemNet > CAS > 776-35-2 9,10-Dihydrophenanthrene
776-35-2 9,10-Dihydrophenanthrene
상품명칭 |
9,10-Dihydrophenanthrene |
별명 |
Dihydrophenanthrene; 9,10-DIHYDROPHENANTHRENE 96+% |
분자식 |
C14H12 |
분자량 |
180.2451 |
InChI |
InChI=1/C14H12/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-8H,9-10H2 |
cas번호 |
776-35-2 |
EC번호 |
212-278-2 |
분자 구조 |
|
밀도 |
1.085g/cm3 |
녹는 점 |
32-35℃ |
비등점 |
307.8°C at 760 mmHg |
굴절 지수 |
1.62 |
인화점 |
144.1°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|