ChemNet > CAS > 782-17-2 2-(4-Fluorophenyl)indole
782-17-2 2-(4-Fluorophenyl)indole
| 상품명칭 |
2-(4-Fluorophenyl)indole |
| 별명 |
2-(naphth-2-yl)-1h-indole; 2-(4-fluorophenyl)-1H-indole; 6-(4-fluorophenyl)-1H-indole |
| 분자식 |
C14H10FN |
| 분자량 |
211.2343 |
| InChI |
InChI=1/C14H10FN/c15-13-5-3-10(4-6-13)12-2-1-11-7-8-16-14(11)9-12/h1-9,16H |
| cas번호 |
782-17-2 |
| 분자 구조 |
|
| 밀도 |
1.233g/cm3 |
| 녹는 점 |
190-192℃ |
| 비등점 |
389.094°C at 760 mmHg |
| 굴절 지수 |
1.658 |
| 인화점 |
189.118°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
