ChemNet > CAS > 782-17-2 2-(4-Fluorophenyl)indole
782-17-2 2-(4-Fluorophenyl)indole
상품명칭 |
2-(4-Fluorophenyl)indole |
별명 |
2-(naphth-2-yl)-1h-indole; 2-(4-fluorophenyl)-1H-indole; 6-(4-fluorophenyl)-1H-indole |
분자식 |
C14H10FN |
분자량 |
211.2343 |
InChI |
InChI=1/C14H10FN/c15-13-5-3-10(4-6-13)12-2-1-11-7-8-16-14(11)9-12/h1-9,16H |
cas번호 |
782-17-2 |
분자 구조 |
|
밀도 |
1.233g/cm3 |
녹는 점 |
190-192℃ |
비등점 |
389.094°C at 760 mmHg |
굴절 지수 |
1.658 |
인화점 |
189.118°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|