ChemNet > CAS > 78686-87-0 2,5-dichloropyridine-3-carbonyl chloride
78686-87-0 2,5-dichloropyridine-3-carbonyl chloride
상품명칭 |
2,5-dichloropyridine-3-carbonyl chloride |
분자식 |
C6H2Cl3NO |
분자량 |
210.4452 |
InChI |
InChI=1/C6H2Cl3NO/c7-3-1-4(6(9)11)5(8)10-2-3/h1-2H |
cas번호 |
78686-87-0 |
분자 구조 |
|
밀도 |
1.582g/cm3 |
비등점 |
269°C at 760 mmHg |
굴절 지수 |
1.582 |
인화점 |
116.5°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|