ChemNet > CAS > 79-35-6 1,1-dichloro-2,2-difluoroethylene
79-35-6 1,1-dichloro-2,2-difluoroethylene
| 상품명칭 |
1,1-dichloro-2,2-difluoroethylene |
| 별명 |
FC-1112a; 1-chloro-1,2,2-trifluoroethene |
| 분자식 |
C2Cl2F2 |
| 분자량 |
132.9242 |
| InChI |
InChI=1/C2Cl2F2/c3-1(4)2(5)6 |
| cas번호 |
79-35-6 |
| EC번호 |
201-198-3 |
| 분자 구조 |
|
| 밀도 |
1.503g/cm3 |
| 비등점 |
17.3°C at 760 mmHg |
| 굴절 지수 |
1.392 |
| 위험성 표시 |
|
| 리스크 규칙 |
R23:Toxic by inhalation.;
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S9:Keep container in a well-ventilated place.;
|
|
