CAS No: 80450-69-7;2630-39-9;151716-36-8, Chemical Name: Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)-
the physical and chemical property of 80450-69-7;2630-39-9;151716-36-8, Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)- is provided by ChemNet.com
ChemNet > CAS > 80450-69-7;2630-39-9;151716-36-8 Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)-
80450-69-7;2630-39-9;151716-36-8 Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)-
| 상품명칭 |
Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)- |
| 별명 |
Methyl trans-dihydrojasmonate; (-)-Methyl dihydrojasmonate; Dihydrojasmonic Acid Methyl Ester; METHYLDIHYDROJASMONATE; methyl [(1R,2R)-3-oxo-2-pentylcyclopentyl]acetate; Methyl 2-(3-Oxo-2-Pentylcyclopentyl)Acetate |
| 분자식 |
C13H22O3 |
| 분자량 |
226.312 |
| InChI |
InChI=1/C13H22O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h10-11H,3-9H2,1-2H3/t10-,11-/m1/s1 |
| cas번호 |
80450-69-7;2630-39-9;151716-36-8 |
| EC번호 |
220-112-5 |
| 분자 구조 |
|
| 밀도 |
0.984g/cm3 |
| 비등점 |
307.8°C at 760 mmHg |
| 굴절 지수 |
1.453 |
| 인화점 |
130.8°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
