ChemNet > CAS > 81029-03-0 2,3-Dimethyl-p-nitroanisole
81029-03-0 2,3-Dimethyl-p-nitroanisole
상품명칭 |
2,3-Dimethyl-p-nitroanisole |
별명 |
2,3-Dimethyl-4-nitroanisole; 1-methoxy-2,3-dimethyl-4-nitrobenzene |
분자식 |
C9H11NO3 |
분자량 |
181.1885 |
InChI |
InChI=1/C9H11NO3/c1-6-7(2)9(13-3)5-4-8(6)10(11)12/h4-5H,1-3H3 |
cas번호 |
81029-03-0 |
EC번호 |
279-674-5 |
분자 구조 |
|
밀도 |
1.148g/cm3 |
녹는 점 |
70-73℃ |
비등점 |
303.2°C at 760 mmHg |
굴절 지수 |
1.534 |
인화점 |
141.2°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|