ChemNet > CAS > 81067-38-1 1-Bromo-2,3,5-trichlorobenzene
81067-38-1 1-Bromo-2,3,5-trichlorobenzene
상품명칭 |
1-Bromo-2,3,5-trichlorobenzene |
별명 |
2,3,5-Trichlorobromobenzene |
분자식 |
C6H2BrCl3 |
분자량 |
260.3431 |
InChI |
InChI=1/C6H2BrCl3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
cas번호 |
81067-38-1 |
분자 구조 |
|
밀도 |
1.84g/cm3 |
녹는 점 |
58-61℃ |
비등점 |
270.8°C at 760 mmHg |
굴절 지수 |
1.603 |
인화점 |
129.3°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|