ChemNet > CAS > 81074-81-9 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo
81074-81-9 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo
상품명칭 |
5-(dimethylaminomethyl)furfuryl alcohol hydrochlo |
별명 |
5-(Dimethylaminomethyl)furfuryl alcohol hydrochloride; {5-[(dimethylamino)methyl]furan-2-yl}methanol hydrochloride |
분자식 |
C8H14ClNO2 |
분자량 |
191.6553 |
InChI |
InChI=1/C8H13NO2.ClH/c1-9(2)5-7-3-4-8(6-10)11-7;/h3-4,10H,5-6H2,1-2H3;1H |
cas번호 |
81074-81-9 |
EC번호 |
279-686-0 |
분자 구조 |
|
녹는 점 |
122-125℃ |
비등점 |
217.7°C at 760 mmHg |
인화점 |
85.5°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|