ChemNet > CAS > 818-23-5 8-Pentadecanone
818-23-5 8-Pentadecanone
상품명칭 |
8-Pentadecanone |
별명 |
Di-n-heptyl ketone; pentadecane-8-one; pentadecan-8-one |
분자식 |
C15H30O |
분자량 |
226.3981 |
InChI |
InChI=1/C15H30O/c1-3-5-7-9-11-13-15(16)14-12-10-8-6-4-2/h3-14H2,1-2H3 |
cas번호 |
818-23-5 |
EC번호 |
212-450-7 |
분자 구조 |
|
밀도 |
0.828g/cm3 |
녹는 점 |
40-44℃ |
비등점 |
292.6°C at 760 mmHg |
굴절 지수 |
1.436 |
인화점 |
83.1°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|