ChemNet > CAS > 824-55-5 1-(chloromethyl)-2,4-dimethylbenzene
824-55-5 1-(chloromethyl)-2,4-dimethylbenzene
상품명칭 |
1-(chloromethyl)-2,4-dimethylbenzene |
별명 |
2,4-Dimethylbenzyl chloride; 4-(Chloromethyl)-m-xylene; 2,4-Dimethylbenzylchloride |
분자식 |
C9H11Cl |
분자량 |
154.6366 |
InChI |
InChI=1/C9H11Cl/c1-7-3-4-9(6-10)8(2)5-7/h3-5H,6H2,1-2H3 |
cas번호 |
824-55-5 |
EC번호 |
212-531-7 |
분자 구조 |
|
밀도 |
1.033g/cm3 |
비등점 |
215.5°C at 760 mmHg |
굴절 지수 |
1.522 |
인화점 |
86.5°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
R36:Irritating to eyes.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|