CAS No: 82586-62-7, Chemical Name: 1,2,3,4-tetrahydro-6,7-dimethoxy-3-isoquinolinecarboxylic acid hydrochloride
the physical and chemical property of 82586-62-7, 1,2,3,4-tetrahydro-6,7-dimethoxy-3-isoquinolinecarboxylic acid hydrochloride is provided by ChemNet.com
ChemNet > CAS > 82586-62-7 1,2,3,4-tetrahydro-6,7-dimethoxy-3-isoquinolinecarboxylic acid hydrochloride
82586-62-7 1,2,3,4-tetrahydro-6,7-dimethoxy-3-isoquinolinecarboxylic acid hydrochloride
상품명칭 |
1,2,3,4-tetrahydro-6,7-dimethoxy-3-isoquinolinecarboxylic acid hydrochloride |
별명 |
6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid hydrochloride; Moexipril Intermediate;
; (3S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid hydrochloride |
분자식 |
C12H16ClNO4 |
분자량 |
273.7127 |
InChI |
InChI=1/C12H15NO4.ClH/c1-16-10-4-7-3-9(12(14)15)13-6-8(7)5-11(10)17-2;/h4-5,9,13H,3,6H2,1-2H3,(H,14,15);1H/t9-;/m0./s1 |
cas번호 |
82586-62-7 |
분자 구조 |
|
녹는 점 |
280-285℃ |
비등점 |
434.8°C at 760 mmHg |
인화점 |
216.7°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|