CAS No: 82632-80-2, Chemical Name: 2,3,6,7,10,11-hexabromotriphenylene
the physical and chemical property of 82632-80-2, 2,3,6,7,10,11-hexabromotriphenylene is provided by ChemNet.com
ChemNet > CAS > 82632-80-2 2,3,6,7,10,11-hexabromotriphenylene
82632-80-2 2,3,6,7,10,11-hexabromotriphenylene
상품명칭 |
2,3,6,7,10,11-hexabromotriphenylene |
별명 |
triphenylene, 2,3,6,7,10,11-hexabromo- |
분자식 |
C18H6Br6 |
분자량 |
701.6642 |
InChI |
InChI=1/C18H6Br6/c19-13-1-7-8(2-14(13)20)10-4-17(23)18(24)6-12(10)11-5-16(22)15(21)3-9(7)11/h1-6H |
cas번호 |
82632-80-2 |
분자 구조 |
|
밀도 |
2.429g/cm3 |
비등점 |
689.788°C at 760 mmHg |
굴절 지수 |
1.822 |
인화점 |
354.305°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|