ChemNet > CAS > 827-15-6 iodopentafluorobenzene
827-15-6 iodopentafluorobenzene
상품명칭 |
iodopentafluorobenzene |
별명 |
Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene |
분자식 |
C6F5I |
분자량 |
293.9607 |
InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
cas번호 |
827-15-6 |
EC번호 |
212-565-2 |
분자 구조 |
|
밀도 |
2.217g/cm3 |
비등점 |
166.7°C at 760 mmHg |
굴절 지수 |
1.502 |
인화점 |
61.3°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|