ChemNet > CAS > 84-60-6 2,6-Dihydroxyanthraquinone
84-60-6 2,6-Dihydroxyanthraquinone
상품명칭 |
2,6-Dihydroxyanthraquinone |
분자식 |
C14H8O4 |
분자량 |
240.2109 |
InChI |
InChI=1/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H |
cas번호 |
84-60-6 |
EC번호 |
201-544-3 |
분자 구조 |
|
밀도 |
1.54g/cm3 |
녹는 점 |
320℃ |
비등점 |
442.1°C at 760 mmHg |
굴절 지수 |
1.732 |
인화점 |
235.3°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|