ChemNet > CAS > 844-51-9 2,5-Diphenyl-p-benzoquinone
844-51-9 2,5-Diphenyl-p-benzoquinone
상품명칭 |
2,5-Diphenyl-p-benzoquinone |
별명 |
2,5-Diphenyl-4-benzoquinone; 2,5-Diphenyl-1,4-benzoquinone; AI3-61046; NSC 8725; 2,5-Cyclohexadiene-1,4-dione, 2,5-diphenyl-; p-Benzoquinone, 2,5-diphenyl- (8CI); 2,5-diphenylcyclohexa-2,5-diene-1,4-dione |
분자식 |
C18H12O2 |
분자량 |
260.2867 |
InChI |
InChI=1/C18H12O2/c19-17-12-16(14-9-5-2-6-10-14)18(20)11-15(17)13-7-3-1-4-8-13/h1-12H |
cas번호 |
844-51-9 |
EC번호 |
212-680-8 |
분자 구조 |
|
밀도 |
1.237g/cm3 |
비등점 |
457.9°C at 760 mmHg |
굴절 지수 |
1.642 |
인화점 |
170.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|