ChemNet > CAS > 86-26-0 2-Methoxybiphenyl
86-26-0 2-Methoxybiphenyl
상품명칭 |
2-Methoxybiphenyl |
별명 |
2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
분자식 |
C13H12O |
분자량 |
184.2338 |
InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
cas번호 |
86-26-0 |
EC번호 |
201-659-9 |
분자 구조 |
|
밀도 |
1.03g/cm3 |
녹는 점 |
30-33℃ |
비등점 |
274°C at 760 mmHg |
굴절 지수 |
1.556 |
인화점 |
101.3°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R33:Danger of cummulative effects.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|