CAS No: 86393-34-2, Chemical Name: 2,4-dichloro-5-fluorobenzoyl chloride
Chemical CAS Database with Global Chemical Suppliers - ChemNet

Updated CAS

the physical and chemical property of 86393-34-2, 2,4-dichloro-5-fluorobenzoyl chloride is provided by ChemNet.com

  ChemNet > CAS > 86393-34-2 2,4-dichloro-5-fluorobenzoyl chloride

86393-34-2 2,4-dichloro-5-fluorobenzoyl chloride

상품명칭 2,4-dichloro-5-fluorobenzoyl chloride
별명 2,4-Dichloro-5-Fluorosbenzoylchloride; 2,4-dichloro-5-Fluoro-benzoyl chloride
분자식 C7H2Cl3FO
분자량 227.4476
InChI InChI=1/C7H2Cl3FO/c8-4-2-5(9)6(11)1-3(4)7(10)12/h1-2H
cas번호 86393-34-2
EC번호 428-390-1
분자 구조 86393-34-2 2,4-dichloro-5-fluorobenzoyl chloride
밀도 1.58g/cm3
비등점 244.1°C at 760 mmHg
굴절 지수 1.556
인화점 108.7°C
위험성 표시  C:Corrosive;
리스크 규칙 R34:;
R36/37:;
보안 규칙 S26:;
S27:;
S28:;
S36/37/39:;
S45:;