ChemNet > CAS > 86454-13-9 2-hydroxy-6-methylisonicotinic acid
86454-13-9 2-hydroxy-6-methylisonicotinic acid
상품명칭 |
2-hydroxy-6-methylisonicotinic acid |
별명 |
6-methyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid; 2-Hydroxy-6-Methylpyridine-4-Carboxylic Acid |
분자식 |
C7H7NO3 |
분자량 |
153.1354 |
InChI |
InChI=1/C7H7NO3/c1-4-2-5(7(10)11)3-6(9)8-4/h2-3H,1H3,(H,8,9)(H,10,11) |
cas번호 |
86454-13-9 |
분자 구조 |
|
밀도 |
1.345g/cm3 |
녹는 점 |
330℃ |
비등점 |
371.2°C at 760 mmHg |
굴절 지수 |
1.555 |
인화점 |
178.3°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|