ChemNet > CAS > 869-29-4 Allylidenediacetate
869-29-4 Allylidenediacetate
| 상품명칭 |
Allylidenediacetate |
| 별명 |
212-789-0; prop-1-ene-3,3-diyl diacetate |
| 분자식 |
C7H10O4 |
| 분자량 |
158.1519 |
| InChI |
InChI=1/C7H10O4/c1-4-7(10-5(2)8)11-6(3)9/h4,7H,1H2,2-3H3 |
| cas번호 |
869-29-4 |
| EC번호 |
212-789-0 |
| 분자 구조 |
|
| 밀도 |
1.079g/cm3 |
| 비등점 |
180°C at 760 mmHg |
| 굴절 지수 |
1.428 |
| 인화점 |
78.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
