ChemNet > CAS > 87-64-9 2-Chloro-6-methylphenol
87-64-9 2-Chloro-6-methylphenol
| 상품명칭 |
2-Chloro-6-methylphenol |
| 별명 |
2-Chloro-6-methylphenol,98%; 6-Chloro-o-cresol (OH=1); 6-Chloro-o-cresol |
| 분자식 |
C7H7ClO |
| 분자량 |
142.5829 |
| InChI |
InChI=1/C7H7ClO/c1-5-3-2-4-6(8)7(5)9/h2-4,9H,1H3 |
| cas번호 |
87-64-9 |
| EC번호 |
201-760-8 |
| 분자 구조 |
|
| 밀도 |
1.228g/cm3 |
| 비등점 |
200.4°C at 760 mmHg |
| 굴절 지수 |
1.565 |
| 인화점 |
75°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R21/22:Harmful in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
