ChemNet > CAS > 87327-69-3 2-Chloro-6-fluoroacetophenone
87327-69-3 2-Chloro-6-fluoroacetophenone
상품명칭 |
2-Chloro-6-fluoroacetophenone |
별명 |
1-(2-chloro-6-fluorophenyl)ethanone; 2'-Chloro-6'-fluoroacetophenone |
분자식 |
C8H6ClFO |
분자량 |
172.584 |
InChI |
InChI=1/C8H6ClFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
cas번호 |
87327-69-3 |
분자 구조 |
|
밀도 |
1.258g/cm3 |
비등점 |
191.8°C at 760 mmHg |
굴절 지수 |
1.512 |
인화점 |
69.8°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|