ChemNet > CAS > 878-00-2 4-Acetoxybenzaldehyde
878-00-2 4-Acetoxybenzaldehyde
상품명칭 |
4-Acetoxybenzaldehyde |
별명 |
4-Formylphenyl acetate |
분자식 |
C9H8O3 |
분자량 |
164.158 |
InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-8(6-10)3-5-9/h2-6H,1H3 |
cas번호 |
878-00-2 |
EC번호 |
212-898-3 |
분자 구조 |
|
밀도 |
1.183g/cm3 |
비등점 |
275°C at 760 mmHg |
굴절 지수 |
1.552 |
인화점 |
119.4°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|