ChemNet > CAS > 881-03-8 2-Methyl-1-nitronaphthalene
881-03-8 2-Methyl-1-nitronaphthalene
| 상품명칭 |
2-Methyl-1-nitronaphthalene |
| 별명 |
Naphthalene, 2-methyl-1-nitro-; 1-Nitro-2-methylnaphthalene; 4-05-00-01698 (Beilstein Handbook Reference); BRN 1954310; CCRIS 4680; NSC 7516 |
| 분자식 |
C11H9NO2 |
| 분자량 |
187.1947 |
| InChI |
InChI=1/C11H9NO2/c1-8-6-7-9-4-2-3-5-10(9)11(8)12(13)14/h2-7H,1H3 |
| cas번호 |
881-03-8 |
| EC번호 |
212-917-5 |
| 분자 구조 |
|
| 밀도 |
1.234g/cm3 |
| 녹는 점 |
79-82℃ |
| 비등점 |
320.5°C at 760 mmHg |
| 굴절 지수 |
1.652 |
| 인화점 |
150.4°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
