ChemNet > CAS > 881-07-2 8-Nitroquinaldine
881-07-2 8-Nitroquinaldine
상품명칭 |
8-Nitroquinaldine |
별명 |
Nitroquinaldine; 2-Methyl-8-nitroquinoline |
분자식 |
C10H8N2O2 |
분자량 |
188.1827 |
InChI |
InChI=1/C10H8N2O2/c1-7-5-6-8-3-2-4-9(12(13)14)10(8)11-7/h2-6H,1H3 |
cas번호 |
881-07-2 |
EC번호 |
212-919-6 |
분자 구조 |
|
밀도 |
1.298g/cm3 |
비등점 |
323.8°C at 760 mmHg |
굴절 지수 |
1.661 |
인화점 |
149.6°C |
위험성 표시 |
|
리스크 규칙 |
R40:Possible risks of irreversible effects.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|