ChemNet > CAS > 89581-82-8 2-Acetyl-3-chlorothiophene
89581-82-8 2-Acetyl-3-chlorothiophene
상품명칭 |
2-Acetyl-3-chlorothiophene |
별명 |
1-(3-chlorothiophen-2-yl)ethanone |
분자식 |
C6H5ClOS |
분자량 |
160.6213 |
InChI |
InChI=1/C6H5ClOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
cas번호 |
89581-82-8 |
분자 구조 |
|
밀도 |
1.312g/cm3 |
비등점 |
219.9°C at 760 mmHg |
굴절 지수 |
1.559 |
인화점 |
86.8°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|