ChemNet > CAS > 89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
상품명칭 |
Methyl-2-chloro-6-methylpyrimidine-4-carboxylate |
별명 |
Methyl 2-chloro-6-methylpyrimidine-4-carboxylate |
분자식 |
C7H7ClN2O2 |
분자량 |
186.5957 |
InChI |
InChI=1/C7H7ClN2O2/c1-4-3-5(6(11)12-2)10-7(8)9-4/h3H,1-2H3 |
cas번호 |
89793-11-3 |
분자 구조 |
|
밀도 |
1.314g/cm3 |
녹는 점 |
107℃ |
비등점 |
306.5°C at 760 mmHg |
굴절 지수 |
1.53 |
인화점 |
139.2°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|