ChemNet > CAS > 9011-14-7;9065-11-6 Poly(methyl methacrylate)
9011-14-7;9065-11-6 Poly(methyl methacrylate)
| 상품명칭 |
Poly(methyl methacrylate) |
| 별명 |
Methyl Methacrylate Resin (High M.Wt.); Methacrylic Acid Methyl Ester, Polymer n=13,500-14,000; PMMA; 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer; Acryloid; Methyl methacrylate homopolymer; Methyl methacrylate, polymerized; Methyl methacrylate resin; Poly(methyl methacrylate), beads |
| 분자식 |
(C5H8O2)x |
| 분자량 |
99.1083 |
| InChI |
InChI=1/C5H7O2/c1-4(2)5(6)7-3/h1H,2-3H3 |
| cas번호 |
9011-14-7;9065-11-6 |
| 분자 구조 |
|
| 밀도 |
1.18 |
| 녹는 점 |
105℃ |
| 굴절 지수 |
1.49 |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
