ChemNet > CAS > 90973-23-2 4-amino-2-piperidino-5-pyrimidinecarbonitrile
90973-23-2 4-amino-2-piperidino-5-pyrimidinecarbonitrile
상품명칭 |
4-amino-2-piperidino-5-pyrimidinecarbonitrile |
분자식 |
C10H13N5 |
분자량 |
203.2437 |
InChI |
InChI=1/C10H13N5/c11-6-8-7-13-10(14-9(8)12)15-4-2-1-3-5-15/h7H,1-5H2,(H2,12,13,14) |
cas번호 |
90973-23-2 |
분자 구조 |
|
밀도 |
1.27g/cm3 |
녹는 점 |
220℃ |
비등점 |
457.1°C at 760 mmHg |
굴절 지수 |
1.615 |
인화점 |
230.2°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|