ChemNet > CAS > 91-43-0 1-Chloro-2,5-diethoxy-4-nitrobenzene
91-43-0 1-Chloro-2,5-diethoxy-4-nitrobenzene
상품명칭 |
1-Chloro-2,5-diethoxy-4-nitrobenzene |
별명 |
Benzene, 1-chloro-2,5-diethoxy-4-nitro-; 2,5-Diethoxy-4-nitrochlorobenzene; 5-Chloro-2-nitro-p-diethoxybenzene; NSC 60284 |
분자식 |
C10H12ClNO4 |
분자량 |
245.6596 |
InChI |
InChI=1/C10H12ClNO4/c1-3-15-9-6-8(12(13)14)10(16-4-2)5-7(9)11/h5-6H,3-4H2,1-2H3 |
cas번호 |
91-43-0 |
EC번호 |
202-067-3 |
분자 구조 |
|
밀도 |
1.264g/cm3 |
비등점 |
368.4°C at 760 mmHg |
굴절 지수 |
1.533 |
인화점 |
176.6°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|