ChemNet > CAS > 91-48-5 alpha-Phenylcinnamic acid
91-48-5 alpha-Phenylcinnamic acid
상품명칭 |
alpha-Phenylcinnamic acid |
별명 |
a-Phenyl-trans-cinnamic acid, Pract.; a-(Phenylmethylene)benzeneacetic acid, Pract.; Phenylcinnamicacid,98%; (2E)-2,3-diphenylprop-2-enoic acid; 2,3-diphenylprop-2-enoic acid; (2Z)-2,3-diphenylprop-2-enoic acid; (2E)-2,3-diphenylprop-2-enoate; (2Z)-2,3-diphenylprop-2-enoate |
분자식 |
C15H11O2 |
분자량 |
223.2472 |
InChI |
InChI=1/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/p-1/b14-11- |
cas번호 |
91-48-5 |
EC번호 |
202-069-4 |
분자 구조 |
|
녹는 점 |
171-175℃ |
비등점 |
336.6°C at 760 mmHg |
인화점 |
239.8°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|