ChemNet > CAS > 92-29-5 Hydrobenzamide
92-29-5 Hydrobenzamide
상품명칭 |
Hydrobenzamide |
별명 |
N,N'-Dibenzylidenetoluene-alpha,alpha-diamine; NSC 1005; Methanediamine, 1-phenyl-N,N'-bis(phenylmethylene)-; Toluene-alpha,alpha-diamine, N,N'-dibenzylidene- (8CI); N,N'-dibenzylidene-1-phenylmethanediamine; 1-phenyl-N,N'-bis[(E)-phenylmethylidene]methanediamine |
분자식 |
C21H18N2 |
분자량 |
298.381 |
InChI |
InChI=1/C21H18N2/c1-4-10-18(11-5-1)16-22-21(20-14-8-3-9-15-20)23-17-19-12-6-2-7-13-19/h1-17,21H/b22-16+,23-17+ |
cas번호 |
92-29-5 |
EC번호 |
202-144-1 |
분자 구조 |
|
밀도 |
1.013g/cm3 |
비등점 |
422.606°C at 760 mmHg |
굴절 지수 |
1.578 |
인화점 |
201.987°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|