ChemNet > CAS > 927-67-3 n-Propylthiourea
927-67-3 n-Propylthiourea
상품명칭 |
n-Propylthiourea |
별명 |
Propyl-2-thiourea; Propylthiourea; Thiourea, propyl-; 1-propylthiourea |
분자식 |
C4H10N2S |
분자량 |
118.2006 |
InChI |
InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
cas번호 |
927-67-3 |
EC번호 |
213-158-2 |
분자 구조 |
|
밀도 |
1.054g/cm3 |
비등점 |
182.1°C at 760 mmHg |
굴절 지수 |
1.537 |
인화점 |
63.9°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|