ChemNet > CAS > 93560-55-5 2-Iodo-3-methoxypyridine
93560-55-5 2-Iodo-3-methoxypyridine
상품명칭 |
2-Iodo-3-methoxypyridine |
분자식 |
C6H6INO |
분자량 |
235.0224 |
InChI |
InChI=1/C6H6INO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3 |
cas번호 |
93560-55-5 |
분자 구조 |
|
밀도 |
1.825g/cm3 |
비등점 |
271.2°C at 760 mmHg |
굴절 지수 |
1.598 |
인화점 |
117.8°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|