ChemNet > CAS > 939-83-3 2-Methyl-5-nitrobenzonitrile
939-83-3 2-Methyl-5-nitrobenzonitrile
상품명칭 |
2-Methyl-5-nitrobenzonitrile |
별명 |
5-Nitro-o-tolunitrile |
분자식 |
C8H6N2O2 |
분자량 |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c1-6-2-3-8(10(11)12)4-7(6)5-9/h2-4H,1H3 |
cas번호 |
939-83-3 |
분자 구조 |
|
밀도 |
1.26g/cm3 |
녹는 점 |
103.5-107.5℃ |
비등점 |
291.5°C at 760 mmHg |
굴절 지수 |
1.568 |
인화점 |
130.1°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|