ChemNet > CAS > 94-46-2 isopentyl benzoate
94-46-2 isopentyl benzoate
상품명칭 |
isopentyl benzoate |
별명 |
Benzoic acid isoamyl ester; 3-methyl-1-butanol benzoate; benzoic acid isopentyl ester; Isoamyl Benzoate; 3-methylbutyl benzoate |
분자식 |
C12H16O2 |
분자량 |
192.2542 |
InChI |
InChI=1/C12H16O2/c1-10(2)8-9-14-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
cas번호 |
94-46-2 |
EC번호 |
202-334-4 |
분자 구조 |
|
밀도 |
0.992g/cm3 |
비등점 |
260°C at 760 mmHg |
굴절 지수 |
1.495 |
인화점 |
109.4°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|